C12H15Cl3INO — CID 134102360
trimethyl-[3-oxo-3-(2,3,6-trichlorophenyl)propyl]azanium iodide (PubChem CID 134102360) has the molecular formula C12H15Cl3INO and a molecular weight of 422.52 g/mol. Its IUPAC name is trimethyl-[3-oxo-3-(2,3,6-trichlorophenyl)propyl]azanium iodide.
| Compound Name | trimethyl-[3-oxo-3-(2,3,6-trichlorophenyl)propyl]azanium iodide |
|---|---|
| PubChem CID | 134102360 |
| Molecular Formula | C12H15Cl3INO |
| Molecular Weight | 422.52 g/mol |
| Exact Mass | 420.93 |
| IUPAC Name | trimethyl-[3-oxo-3-(2,3,6-trichlorophenyl)propyl]azanium iodide |
| SMILES | C[N+](C)(C)CCC(=O)c1c(Cl)ccc(Cl)c1Cl.[I-] |
| InChI | InChI=1S/C12H15Cl3NO.HI/c1-16(2,3)7-6-10(17)11-8(13)4-5-9(14)12(11)15;/h4-5H,6-7H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | ZLADWYGZINMJMY-UHFFFAOYSA-M |
| XLogP | 0.93 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.52 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|