C8H3Cl3O3 — CID 175136056
formyl 2,3,6-trichlorobenzoate (PubChem CID 175136056) has the molecular formula C8H3Cl3O3 and a molecular weight of 253.47 g/mol. Its IUPAC name is formyl 2,3,6-trichlorobenzoate.
| Compound Name | formyl 2,3,6-trichlorobenzoate |
|---|---|
| PubChem CID | 175136056 |
| Molecular Formula | C8H3Cl3O3 |
| Molecular Weight | 253.47 g/mol |
| Exact Mass | 251.91 |
| IUPAC Name | formyl 2,3,6-trichlorobenzoate |
| SMILES | O=COC(=O)c1c(Cl)ccc(Cl)c1Cl |
| InChI | InChI=1S/C8H3Cl3O3/c9-4-1-2-5(10)7(11)6(4)8(13)14-3-12/h1-3H |
| InChIKey | QYOBBNDVXRYOGT-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.47 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|