C8H4Cl3NaO3 — CID 175136055
sodium;formyl 2,3,6-trichlorobenzoate;hydride (PubChem CID 175136055) has the molecular formula C8H4Cl3NaO3 and a molecular weight of 277.47 g/mol. Its IUPAC name is sodium;formyl 2,3,6-trichlorobenzoate;hydride.
| Compound Name | sodium;formyl 2,3,6-trichlorobenzoate;hydride |
|---|---|
| PubChem CID | 175136055 |
| Molecular Formula | C8H4Cl3NaO3 |
| Molecular Weight | 277.47 g/mol |
| Exact Mass | 275.91 |
| IUPAC Name | sodium;formyl 2,3,6-trichlorobenzoate;hydride |
| SMILES | O=COC(=O)c1c(Cl)ccc(Cl)c1Cl.[H-].[Na+] |
| InChI | InChI=1S/C8H3Cl3O3.Na.H/c9-4-1-2-5(10)7(11)6(4)8(13)14-3-12;;/h1-3H;;/q;+1;-1 |
| InChIKey | FCYOMPMWWJRGMO-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.47 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|