C12H14N+ — CID 134103157
1,2,7-trimethylquinolin-1-ium (PubChem CID 134103157) has the molecular formula C12H14N+ and a molecular weight of 172.25 g/mol. Its IUPAC name is 1,2,7-trimethylquinolin-1-ium.
| Compound Name | 1,2,7-trimethylquinolin-1-ium |
|---|---|
| PubChem CID | 134103157 |
| Molecular Formula | C12H14N+ |
| Molecular Weight | 172.25 g/mol |
| Exact Mass | 172.11 |
| IUPAC Name | 1,2,7-trimethylquinolin-1-ium |
| SMILES | Cc1ccc2ccc(C)[n+](C)c2c1 |
| InChI | InChI=1S/C12H14N/c1-9-4-6-11-7-5-10(2)13(3)12(11)8-9/h4-8H,1-3H3/q+1 |
| InChIKey | RLQTXVHRCRIJRJ-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.25 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|