C16H16N+ — CID 18342016
3,6,10-trimethylacridin-10-ium (PubChem CID 18342016) has the molecular formula C16H16N+ and a molecular weight of 222.31 g/mol. Its IUPAC name is 3,6,10-trimethylacridin-10-ium.
| Compound Name | 3,6,10-trimethylacridin-10-ium |
|---|---|
| PubChem CID | 18342016 |
| Molecular Formula | C16H16N+ |
| Molecular Weight | 222.31 g/mol |
| Exact Mass | 222.13 |
| IUPAC Name | 3,6,10-trimethylacridin-10-ium |
| SMILES | Cc1ccc2cc3ccc(C)cc3[n+](C)c2c1 |
| InChI | InChI=1S/C16H16N/c1-11-4-6-13-10-14-7-5-12(2)9-16(14)17(3)15(13)8-11/h4-10H,1-3H3/q+1 |
| InChIKey | IHVYHDFAGNLJFU-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.31 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|