C13H11ClN2O2S — CID 134104535
3-chloro-5-(2-methyl-6-prop-2-enylphenoxy)-1,2,6-thiadiazin-4-one (PubChem CID 134104535) has the molecular formula C13H11ClN2O2S and a molecular weight of 294.76 g/mol. Its IUPAC name is 3-chloro-5-(2-methyl-6-prop-2-enylphenoxy)-1,2,6-thiadiazin-4-one.
| Compound Name | 3-chloro-5-(2-methyl-6-prop-2-enylphenoxy)-1,2,6-thiadiazin-4-one |
|---|---|
| PubChem CID | 134104535 |
| Molecular Formula | C13H11ClN2O2S |
| Molecular Weight | 294.76 g/mol |
| Exact Mass | 294.02 |
| IUPAC Name | 3-chloro-5-(2-methyl-6-prop-2-enylphenoxy)-1,2,6-thiadiazin-4-one |
| SMILES | C=CCc1cccc(C)c1Oc1nsnc(Cl)c1=O |
| InChI | InChI=1S/C13H11ClN2O2S/c1-3-5-9-7-4-6-8(2)11(9)18-13-10(17)12(14)15-19-16-13/h3-4,6-7H,1,5H2,2H3 |
| InChIKey | MUDKZBMXTDSKMZ-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.76 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|