C16H18BrF3N6O — CID 134108238
4-N-[(3-bromophenyl)methyl]-6-morpholin-4-yl-2-N-(2,2,2-trifluoroethyl)-1,3,5-triazine-2,4-diamine (PubChem CID 134108238) has the molecular formula C16H18BrF3N6O and a molecular weight of 447.26 g/mol. Its IUPAC name is 4-N-[(3-bromophenyl)methyl]-6-morpholin-4-yl-2-N-(2,2,2-trifluoroethyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 4-N-[(3-bromophenyl)methyl]-6-morpholin-4-yl-2-N-(2,2,2-trifluoroethyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 134108238 |
| Molecular Formula | C16H18BrF3N6O |
| Molecular Weight | 447.26 g/mol |
| Exact Mass | 446.07 |
| IUPAC Name | 4-N-[(3-bromophenyl)methyl]-6-morpholin-4-yl-2-N-(2,2,2-trifluoroethyl)-1,3,5-triazine-2,4-diamine |
| SMILES | FC(F)(F)CNc1nc(NCc2cccc(Br)c2)nc(N2CCOCC2)n1 |
| InChI | InChI=1S/C16H18BrF3N6O/c17-12-3-1-2-11(8-12)9-21-13-23-14(22-10-16(18,19)20)25-15(24-13)26-4-6-27-7-5-26/h1-3,8H,4-7,9-10H2,(H2,21,22,23,24,25) |
| InChIKey | GBUZRVHPEONRIO-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 75.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.26 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |