C21H17ClFNO3 — CID 134110322
2-[4-[(3-chlorophenyl)methoxy]-2-fluorophenyl]-4,5,6,7-tetrahydroisoindole-1,3-dione (PubChem CID 134110322) has the molecular formula C21H17ClFNO3 and a molecular weight of 385.82 g/mol. Its IUPAC name is 2-[4-[(3-chlorophenyl)methoxy]-2-fluorophenyl]-4,5,6,7-tetrahydroisoindole-1,3-dione.
| Compound Name | 2-[4-[(3-chlorophenyl)methoxy]-2-fluorophenyl]-4,5,6,7-tetrahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 134110322 |
| Molecular Formula | C21H17ClFNO3 |
| Molecular Weight | 385.82 g/mol |
| Exact Mass | 385.09 |
| IUPAC Name | 2-[4-[(3-chlorophenyl)methoxy]-2-fluorophenyl]-4,5,6,7-tetrahydroisoindole-1,3-dione |
| SMILES | O=C1C2=C(CCCC2)C(=O)N1c1ccc(OCc2cccc(Cl)c2)cc1F |
| InChI | InChI=1S/C21H17ClFNO3/c22-14-5-3-4-13(10-14)12-27-15-8-9-19(18(23)11-15)24-20(25)16-6-1-2-7-17(16)21(24)26/h3-5,8-11H,1-2,6-7,12H2 |
| InChIKey | GAZDHNAWFYMHAM-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.82 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|