C20H16ClFN2O3 — CID 14460654
2-[5-(4-aminophenoxy)-4-chloro-2-fluorophenyl]-4,5,6,7-tetrahydroisoindole-1,3-dione (PubChem CID 14460654) has the molecular formula C20H16ClFN2O3 and a molecular weight of 386.81 g/mol. Its IUPAC name is 2-[5-(4-aminophenoxy)-4-chloro-2-fluorophenyl]-4,5,6,7-tetrahydroisoindole-1,3-dione.
| Compound Name | 2-[5-(4-aminophenoxy)-4-chloro-2-fluorophenyl]-4,5,6,7-tetrahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 14460654 |
| Molecular Formula | C20H16ClFN2O3 |
| Molecular Weight | 386.81 g/mol |
| Exact Mass | 386.08 |
| IUPAC Name | 2-[5-(4-aminophenoxy)-4-chloro-2-fluorophenyl]-4,5,6,7-tetrahydroisoindole-1,3-dione |
| SMILES | Nc1ccc(Oc2cc(N3C(=O)C4=C(CCCC4)C3=O)c(F)cc2Cl)cc1 |
| InChI | InChI=1S/C20H16ClFN2O3/c21-15-9-16(22)17(10-18(15)27-12-7-5-11(23)6-8-12)24-19(25)13-3-1-2-4-14(13)20(24)26/h5-10H,1-4,23H2 |
| InChIKey | HBYTZRXBLFCYDX-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.81 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|