C12H19N5S — CID 134111928
3-(4-cyano-3-propan-2-yl-1,2-thiazol-5-yl)-2-ethyl-1,1-dimethylguanidine (PubChem CID 134111928) has the molecular formula C12H19N5S and a molecular weight of 265.39 g/mol. Its IUPAC name is 3-(4-cyano-3-propan-2-yl-1,2-thiazol-5-yl)-2-ethyl-1,1-dimethylguanidine.
| Compound Name | 3-(4-cyano-3-propan-2-yl-1,2-thiazol-5-yl)-2-ethyl-1,1-dimethylguanidine |
|---|---|
| PubChem CID | 134111928 |
| Molecular Formula | C12H19N5S |
| Molecular Weight | 265.39 g/mol |
| Exact Mass | 265.14 |
| IUPAC Name | 3-(4-cyano-3-propan-2-yl-1,2-thiazol-5-yl)-2-ethyl-1,1-dimethylguanidine |
| SMILES | CC/N=C(/Nc1snc(C(C)C)c1C#N)N(C)C |
| InChI | InChI=1S/C12H19N5S/c1-6-14-12(17(4)5)15-11-9(7-13)10(8(2)3)16-18-11/h8H,6H2,1-5H3,(H,14,15) |
| InChIKey | IXMTYSARBNUWFV-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 64.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.39 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|