C14H20N6 — CID 134112290
1-benzyl-N-(piperidin-1-ylmethyl)tetrazol-5-amine (PubChem CID 134112290) has the molecular formula C14H20N6 and a molecular weight of 272.36 g/mol. Its IUPAC name is 1-benzyl-N-(piperidin-1-ylmethyl)tetrazol-5-amine.
| Compound Name | 1-benzyl-N-(piperidin-1-ylmethyl)tetrazol-5-amine |
|---|---|
| PubChem CID | 134112290 |
| Molecular Formula | C14H20N6 |
| Molecular Weight | 272.36 g/mol |
| Exact Mass | 272.17 |
| IUPAC Name | 1-benzyl-N-(piperidin-1-ylmethyl)tetrazol-5-amine |
| SMILES | c1ccc(Cn2nnnc2NCN2CCCCC2)cc1 |
| InChI | InChI=1S/C14H20N6/c1-3-7-13(8-4-1)11-20-14(16-17-18-20)15-12-19-9-5-2-6-10-19/h1,3-4,7-8H,2,5-6,9-12H2,(H,15,16,18) |
| InChIKey | XARDDKSDPRKZBF-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 58.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.36 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |