C16H13Cl2NO3S — CID 134117749
4-(3,4-dichloroanilino)-4-oxo-2-phenylsulfanylbutanoic acid (PubChem CID 134117749) has the molecular formula C16H13Cl2NO3S and a molecular weight of 370.26 g/mol. Its IUPAC name is 4-(3,4-dichloroanilino)-4-oxo-2-phenylsulfanylbutanoic acid.
| Compound Name | 4-(3,4-dichloroanilino)-4-oxo-2-phenylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 134117749 |
| Molecular Formula | C16H13Cl2NO3S |
| Molecular Weight | 370.26 g/mol |
| Exact Mass | 369.00 |
| IUPAC Name | 4-(3,4-dichloroanilino)-4-oxo-2-phenylsulfanylbutanoic acid |
| SMILES | O=C(CC(Sc1ccccc1)C(=O)O)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C16H13Cl2NO3S/c17-12-7-6-10(8-13(12)18)19-15(20)9-14(16(21)22)23-11-4-2-1-3-5-11/h1-8,14H,9H2,(H,19,20)(H,21,22) |
| InChIKey | NOPNFPPTJFLEBR-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.26 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |