C17H23NO5 — CID 134121637
6-(1-carboxycyclohexyl)-2,4-dimethyl-7-oxo-6-azabicyclo[3.2.1]oct-3-ene-8-carboxylic acid (PubChem CID 134121637) has the molecular formula C17H23NO5 and a molecular weight of 321.37 g/mol. Its IUPAC name is 6-(1-carboxycyclohexyl)-2,4-dimethyl-7-oxo-6-azabicyclo[3.2.1]oct-3-ene-8-carboxylic acid.
| Compound Name | 6-(1-carboxycyclohexyl)-2,4-dimethyl-7-oxo-6-azabicyclo[3.2.1]oct-3-ene-8-carboxylic acid |
|---|---|
| PubChem CID | 134121637 |
| Molecular Formula | C17H23NO5 |
| Molecular Weight | 321.37 g/mol |
| Exact Mass | 321.16 |
| IUPAC Name | 6-(1-carboxycyclohexyl)-2,4-dimethyl-7-oxo-6-azabicyclo[3.2.1]oct-3-ene-8-carboxylic acid |
| SMILES | CC1=CC(C)C2C(=O)N(C3(C(=O)O)CCCCC3)C1C2C(=O)O |
| InChI | InChI=1S/C17H23NO5/c1-9-8-10(2)13-12(15(20)21)11(9)14(19)18(13)17(16(22)23)6-4-3-5-7-17/h8-9,11-13H,3-7H2,1-2H3,(H,20,21)(H,22,23) |
| InChIKey | UBCNREHSHPAWRY-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.37 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|