C15H10F7N3O2 — CID 134122504
(1Z)-1-[2-(1,1,2,2,3,3,3-heptafluoropropyl)-1-hydroxy-4-pyridinylidene]-3-phenylurea (PubChem CID 134122504) has the molecular formula C15H10F7N3O2 and a molecular weight of 397.25 g/mol. Its IUPAC name is (1Z)-1-[2-(1,1,2,2,3,3,3-heptafluoropropyl)-1-hydroxy-4-pyridinylidene]-3-phenylurea.
| Compound Name | (1Z)-1-[2-(1,1,2,2,3,3,3-heptafluoropropyl)-1-hydroxy-4-pyridinylidene]-3-phenylurea |
|---|---|
| PubChem CID | 134122504 |
| Molecular Formula | C15H10F7N3O2 |
| Molecular Weight | 397.25 g/mol |
| Exact Mass | 397.07 |
| IUPAC Name | (1Z)-1-[2-(1,1,2,2,3,3,3-heptafluoropropyl)-1-hydroxy-4-pyridinylidene]-3-phenylurea |
| SMILES | O=C(/N=c1/ccn(O)c(C(F)(F)C(F)(F)C(F)(F)F)c1)Nc1ccccc1 |
| InChI | InChI=1S/C15H10F7N3O2/c16-13(17,14(18,19)15(20,21)22)11-8-10(6-7-25(11)27)24-12(26)23-9-4-2-1-3-5-9/h1-8,27H,(H,23,26)/b24-10- |
| InChIKey | VUZKDQFMYOUQLF-VROXFSQNSA-N |
| XLogP | 4.15 |
| TPSA | 66.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.25 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|