C18H13F3N4O — CID 21246254
(1Z)-1-(1-phenylpyridazin-4-ylidene)-3-[3-(trifluoromethyl)phenyl]urea (PubChem CID 21246254) has the molecular formula C18H13F3N4O and a molecular weight of 358.32 g/mol. Its IUPAC name is (1Z)-1-(1-phenylpyridazin-4-ylidene)-3-[3-(trifluoromethyl)phenyl]urea.
| Compound Name | (1Z)-1-(1-phenylpyridazin-4-ylidene)-3-[3-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 21246254 |
| Molecular Formula | C18H13F3N4O |
| Molecular Weight | 358.32 g/mol |
| Exact Mass | 358.10 |
| IUPAC Name | (1Z)-1-(1-phenylpyridazin-4-ylidene)-3-[3-(trifluoromethyl)phenyl]urea |
| SMILES | O=C(/N=c1/ccn(-c2ccccc2)nc1)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H13F3N4O/c19-18(20,21)13-5-4-6-14(11-13)23-17(26)24-15-9-10-25(22-12-15)16-7-2-1-3-8-16/h1-12H,(H,23,26)/b24-15- |
| InChIKey | MPGZSHNRFJDLDU-IWIPYMOSSA-N |
| XLogP | 4.02 |
| TPSA | 59.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.32 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |