C12H6F7N3O2S — CID 135517834
1-[5-fluoro-4-oxo-5-(trifluoromethyl)-1,3-thiazolidin-2-ylidene]-3-[3-(trifluoromethyl)phenyl]urea (PubChem CID 135517834) has the molecular formula C12H6F7N3O2S and a molecular weight of 389.25 g/mol. Its IUPAC name is 1-[5-fluoro-4-oxo-5-(trifluoromethyl)-1,3-thiazolidin-2-ylidene]-3-[3-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[5-fluoro-4-oxo-5-(trifluoromethyl)-1,3-thiazolidin-2-ylidene]-3-[3-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 135517834 |
| Molecular Formula | C12H6F7N3O2S |
| Molecular Weight | 389.25 g/mol |
| Exact Mass | 389.01 |
| IUPAC Name | 1-[5-fluoro-4-oxo-5-(trifluoromethyl)-1,3-thiazolidin-2-ylidene]-3-[3-(trifluoromethyl)phenyl]urea |
| SMILES | O=C(N=C1NC(=O)C(F)(C(F)(F)F)S1)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H6F7N3O2S/c13-10(12(17,18)19)7(23)21-9(25-10)22-8(24)20-6-3-1-2-5(4-6)11(14,15)16/h1-4H,(H2,20,21,22,23,24) |
| InChIKey | ZJEUMCUVWHWNLF-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.25 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|