C22H18N4O2S — CID 15500443
(1E)-1-(2-oxo-1,3-diphenyl-5-sulfanylimidazolidin-4-ylidene)-3-phenylurea (PubChem CID 15500443) has the molecular formula C22H18N4O2S and a molecular weight of 402.48 g/mol. Its IUPAC name is (1E)-1-(2-oxo-1,3-diphenyl-5-sulfanylimidazolidin-4-ylidene)-3-phenylurea.
| Compound Name | (1E)-1-(2-oxo-1,3-diphenyl-5-sulfanylimidazolidin-4-ylidene)-3-phenylurea |
|---|---|
| PubChem CID | 15500443 |
| Molecular Formula | C22H18N4O2S |
| Molecular Weight | 402.48 g/mol |
| Exact Mass | 402.12 |
| IUPAC Name | (1E)-1-(2-oxo-1,3-diphenyl-5-sulfanylimidazolidin-4-ylidene)-3-phenylurea |
| SMILES | O=C(/N=C1\C(S)N(c2ccccc2)C(=O)N1c1ccccc1)Nc1ccccc1 |
| InChI | InChI=1S/C22H18N4O2S/c27-21(23-16-10-4-1-5-11-16)24-19-20(29)26(18-14-8-3-9-15-18)22(28)25(19)17-12-6-2-7-13-17/h1-15,20,29H,(H,23,27)/b24-19+ |
| InChIKey | GXCMIYYRPMXDGJ-LYBHJNIJSA-N |
| XLogP | 5.02 |
| TPSA | 65.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.48 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|