C20H22N4O4 — CID 71411277
1-(5,5-diethoxy-2-oxo-3-phenylimidazolidin-4-ylidene)-3-phenylurea (PubChem CID 71411277) has the molecular formula C20H22N4O4 and a molecular weight of 382.42 g/mol. Its IUPAC name is 1-(5,5-diethoxy-2-oxo-3-phenylimidazolidin-4-ylidene)-3-phenylurea.
| Compound Name | 1-(5,5-diethoxy-2-oxo-3-phenylimidazolidin-4-ylidene)-3-phenylurea |
|---|---|
| PubChem CID | 71411277 |
| Molecular Formula | C20H22N4O4 |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.16 |
| IUPAC Name | 1-(5,5-diethoxy-2-oxo-3-phenylimidazolidin-4-ylidene)-3-phenylurea |
| SMILES | CCOC1(OCC)NC(=O)N(c2ccccc2)C1=NC(=O)Nc1ccccc1 |
| InChI | InChI=1S/C20H22N4O4/c1-3-27-20(28-4-2)17(22-18(25)21-15-11-7-5-8-12-15)24(19(26)23-20)16-13-9-6-10-14-16/h5-14H,3-4H2,1-2H3,(H,21,25)(H,23,26) |
| InChIKey | WHGMRDCVRRCXBF-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|