C16H32I2N2 — CID 134124353
trimethyl-[(3Z,8Z)-6-(trimethylazaniumyl)cyclodeca-3,8-dien-1-yl]azanium diiodide (PubChem CID 134124353) has the molecular formula C16H32I2N2 and a molecular weight of 506.25 g/mol. Its IUPAC name is trimethyl-[(3Z,8Z)-6-(trimethylazaniumyl)cyclodeca-3,8-dien-1-yl]azanium diiodide.
| Compound Name | trimethyl-[(3Z,8Z)-6-(trimethylazaniumyl)cyclodeca-3,8-dien-1-yl]azanium diiodide |
|---|---|
| PubChem CID | 134124353 |
| Molecular Formula | C16H32I2N2 |
| Molecular Weight | 506.25 g/mol |
| Exact Mass | 506.07 |
| IUPAC Name | trimethyl-[(3Z,8Z)-6-(trimethylazaniumyl)cyclodeca-3,8-dien-1-yl]azanium diiodide |
| SMILES | C[N+](C)(C)C1C/C=C\CC([N+](C)(C)C)C/C=C\C1.[I-].[I-] |
| InChI | InChI=1S/C16H32N2.2HI/c1-17(2,3)15-11-7-9-13-16(18(4,5)6)14-10-8-12-15;;/h7-10,15-16H,11-14H2,1-6H3;2*1H/q+2;;/p-2/b9-7-,10-8-;; |
| InChIKey | NVAAVOKHCUAFNC-RXRQIEPESA-L |
| XLogP | -3.17 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.25 |
| LogP ≤ 5 | -3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|