C29H35N3O5 — CID 134131061
[4-[(E)-3-[4-(dimethylamino)phenyl]prop-2-enoyl]-3-(piperidine-1-carbonyloxy)phenyl] piperidine-1-carboxylate (PubChem CID 134131061) has the molecular formula C29H35N3O5 and a molecular weight of 505.62 g/mol. Its IUPAC name is [4-[(E)-3-[4-(dimethylamino)phenyl]prop-2-enoyl]-3-(piperidine-1-carbonyloxy)phenyl] piperidine-1-carboxylate.
| Compound Name | [4-[(E)-3-[4-(dimethylamino)phenyl]prop-2-enoyl]-3-(piperidine-1-carbonyloxy)phenyl] piperidine-1-carboxylate |
|---|---|
| PubChem CID | 134131061 |
| Molecular Formula | C29H35N3O5 |
| Molecular Weight | 505.62 g/mol |
| Exact Mass | 505.26 |
| IUPAC Name | [4-[(E)-3-[4-(dimethylamino)phenyl]prop-2-enoyl]-3-(piperidine-1-carbonyloxy)phenyl] piperidine-1-carboxylate |
| SMILES | CN(C)c1ccc(/C=C/C(=O)c2ccc(OC(=O)N3CCCCC3)cc2OC(=O)N2CCCCC2)cc1 |
| InChI | InChI=1S/C29H35N3O5/c1-30(2)23-12-9-22(10-13-23)11-16-26(33)25-15-14-24(36-28(34)31-17-5-3-6-18-31)21-27(25)37-29(35)32-19-7-4-8-20-32/h9-16,21H,3-8,17-20H2,1-2H3/b16-11+ |
| InChIKey | ZTAKHXSJKZNPTR-LFIBNONCSA-N |
| XLogP | 5.62 |
| TPSA | 79.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.62 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|