C20H36N6O2 — CID 134136973
4-(diaminomethylideneamino)butyl (3S)-1-amino-3-heptyl-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidine-4-carboxylate (PubChem CID 134136973) has the molecular formula C20H36N6O2 and a molecular weight of 392.55 g/mol. Its IUPAC name is 4-(diaminomethylideneamino)butyl (3S)-1-amino-3-heptyl-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidine-4-carboxylate.
| Compound Name | 4-(diaminomethylideneamino)butyl (3S)-1-amino-3-heptyl-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidine-4-carboxylate |
|---|---|
| PubChem CID | 134136973 |
| Molecular Formula | C20H36N6O2 |
| Molecular Weight | 392.55 g/mol |
| Exact Mass | 392.29 |
| IUPAC Name | 4-(diaminomethylideneamino)butyl (3S)-1-amino-3-heptyl-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidine-4-carboxylate |
| SMILES | CCCCCCC[C@@H]1N=C(N)N2CCCC2=C1C(=O)OCCCCN=C(N)N |
| InChI | InChI=1S/C20H36N6O2/c1-2-3-4-5-6-10-15-17(16-11-9-13-26(16)20(23)25-15)18(27)28-14-8-7-12-24-19(21)22/h15H,2-14H2,1H3,(H2,23,25)(H4,21,22,24)/t15-/m0/s1 |
| InChIKey | DBCFANJJFGERBS-HNNXBMFYSA-N |
| XLogP | 1.99 |
| TPSA | 132.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.55 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|