C22H39N6O2+ — CID 134145908
4-(diaminomethylideneamino)butyl 1-amino-3-nonyl-6,7-dihydro-5H-pyrrolo[1,2-c]pyrimidin-8-ium-4-carboxylate (PubChem CID 134145908) has the molecular formula C22H39N6O2+ and a molecular weight of 419.59 g/mol. Its IUPAC name is 4-(diaminomethylideneamino)butyl 1-amino-3-nonyl-6,7-dihydro-5H-pyrrolo[1,2-c]pyrimidin-8-ium-4-carboxylate.
| Compound Name | 4-(diaminomethylideneamino)butyl 1-amino-3-nonyl-6,7-dihydro-5H-pyrrolo[1,2-c]pyrimidin-8-ium-4-carboxylate |
|---|---|
| PubChem CID | 134145908 |
| Molecular Formula | C22H39N6O2+ |
| Molecular Weight | 419.59 g/mol |
| Exact Mass | 419.31 |
| IUPAC Name | 4-(diaminomethylideneamino)butyl 1-amino-3-nonyl-6,7-dihydro-5H-pyrrolo[1,2-c]pyrimidin-8-ium-4-carboxylate |
| SMILES | CCCCCCCCCc1nc(N)[n+]2c(c1C(=O)OCCCCN=C(N)N)CCC2 |
| InChI | InChI=1S/C22H38N6O2/c1-2-3-4-5-6-7-8-12-17-19(18-13-11-15-28(18)22(25)27-17)20(29)30-16-10-9-14-26-21(23)24/h25H,2-16H2,1H3,(H4,23,24,26)/p+1 |
| InChIKey | ZSESMTWOSVTWCN-UHFFFAOYSA-O |
| XLogP | 2.40 |
| TPSA | 133.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.59 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|