C24H46N6O3 — CID 163117190
6-(diaminomethylideneamino)hexyl 9-amino-7-nonyl-1-oxa-8,10-diazaspiro[4.5]dec-8-ene-6-carboxylate (PubChem CID 163117190) has the molecular formula C24H46N6O3 and a molecular weight of 466.67 g/mol. Its IUPAC name is 6-(diaminomethylideneamino)hexyl 9-amino-7-nonyl-1-oxa-8,10-diazaspiro[4.5]dec-8-ene-6-carboxylate.
| Compound Name | 6-(diaminomethylideneamino)hexyl 9-amino-7-nonyl-1-oxa-8,10-diazaspiro[4.5]dec-8-ene-6-carboxylate |
|---|---|
| PubChem CID | 163117190 |
| Molecular Formula | C24H46N6O3 |
| Molecular Weight | 466.67 g/mol |
| Exact Mass | 466.36 |
| IUPAC Name | 6-(diaminomethylideneamino)hexyl 9-amino-7-nonyl-1-oxa-8,10-diazaspiro[4.5]dec-8-ene-6-carboxylate |
| SMILES | CCCCCCCCCC1N=C(N)NC2(CCCO2)C1C(=O)OCCCCCCN=C(N)N |
| InChI | InChI=1S/C24H46N6O3/c1-2-3-4-5-6-7-10-14-19-20(24(15-13-18-33-24)30-23(27)29-19)21(31)32-17-12-9-8-11-16-28-22(25)26/h19-20H,2-18H2,1H3,(H4,25,26,28)(H3,27,29,30) |
| InChIKey | AFMIZLXDHGVNLP-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 150.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.67 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|