C29H52N6O2 — CID 163147435
4-(diaminomethylideneamino)butyl (1S,10R)-10-nonyl-6-pentyl-7,9,12-triazatricyclo[6.3.1.04,12]dodeca-4,6-diene-5-carboxylate (PubChem CID 163147435) has the molecular formula C29H52N6O2 and a molecular weight of 516.78 g/mol. Its IUPAC name is 4-(diaminomethylideneamino)butyl (1S,10R)-10-nonyl-6-pentyl-7,9,12-triazatricyclo[6.3.1.04,12]dodeca-4,6-diene-5-carboxylate.
| Compound Name | 4-(diaminomethylideneamino)butyl (1S,10R)-10-nonyl-6-pentyl-7,9,12-triazatricyclo[6.3.1.04,12]dodeca-4,6-diene-5-carboxylate |
|---|---|
| PubChem CID | 163147435 |
| Molecular Formula | C29H52N6O2 |
| Molecular Weight | 516.78 g/mol |
| Exact Mass | 516.42 |
| IUPAC Name | 4-(diaminomethylideneamino)butyl (1S,10R)-10-nonyl-6-pentyl-7,9,12-triazatricyclo[6.3.1.04,12]dodeca-4,6-diene-5-carboxylate |
| SMILES | CCCCCCCCC[C@@H]1C[C@@H]2CCC3=C(C(=O)OCCCCN=C(N)N)C(CCCCC)=NC(N1)N32 |
| InChI | InChI=1S/C29H52N6O2/c1-3-5-7-8-9-10-12-15-22-21-23-17-18-25-26(27(36)37-20-14-13-19-32-28(30)31)24(16-11-6-4-2)34-29(33-22)35(23)25/h22-23,29,33H,3-21H2,1-2H3,(H4,30,31,32)/t22-,23+,29?/m1/s1 |
| InChIKey | MCDZOCGSYWVZNW-NIMHCUBFSA-N |
| XLogP | 5.12 |
| TPSA | 118.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.78 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|