C23H19Cl2N5O3 — CID 134144616
1-(2,3-dichlorophenyl)-3-[4-(3,5-dimethoxyanilino)quinazolin-8-yl]urea (PubChem CID 134144616) has the molecular formula C23H19Cl2N5O3 and a molecular weight of 484.34 g/mol. Its IUPAC name is 1-(2,3-dichlorophenyl)-3-[4-(3,5-dimethoxyanilino)quinazolin-8-yl]urea.
| Compound Name | 1-(2,3-dichlorophenyl)-3-[4-(3,5-dimethoxyanilino)quinazolin-8-yl]urea |
|---|---|
| PubChem CID | 134144616 |
| Molecular Formula | C23H19Cl2N5O3 |
| Molecular Weight | 484.34 g/mol |
| Exact Mass | 483.09 |
| IUPAC Name | 1-(2,3-dichlorophenyl)-3-[4-(3,5-dimethoxyanilino)quinazolin-8-yl]urea |
| SMILES | COc1cc(Nc2ncnc3c(NC(=O)Nc4cccc(Cl)c4Cl)cccc23)cc(OC)c1 |
| InChI | InChI=1S/C23H19Cl2N5O3/c1-32-14-9-13(10-15(11-14)33-2)28-22-16-5-3-8-19(21(16)26-12-27-22)30-23(31)29-18-7-4-6-17(24)20(18)25/h3-12H,1-2H3,(H,26,27,28)(H2,29,30,31) |
| InChIKey | NXXNUQKOVKJMHX-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 97.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.34 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |