C25H19F6N5O3 — CID 134157626
1-[3,5-bis(trifluoromethyl)phenyl]-3-[4-(3,5-dimethoxyanilino)quinazolin-8-yl]urea (PubChem CID 134157626) has the molecular formula C25H19F6N5O3 and a molecular weight of 551.45 g/mol. Its IUPAC name is 1-[3,5-bis(trifluoromethyl)phenyl]-3-[4-(3,5-dimethoxyanilino)quinazolin-8-yl]urea.
| Compound Name | 1-[3,5-bis(trifluoromethyl)phenyl]-3-[4-(3,5-dimethoxyanilino)quinazolin-8-yl]urea |
|---|---|
| PubChem CID | 134157626 |
| Molecular Formula | C25H19F6N5O3 |
| Molecular Weight | 551.45 g/mol |
| Exact Mass | 551.14 |
| IUPAC Name | 1-[3,5-bis(trifluoromethyl)phenyl]-3-[4-(3,5-dimethoxyanilino)quinazolin-8-yl]urea |
| SMILES | COc1cc(Nc2ncnc3c(NC(=O)Nc4cc(C(F)(F)F)cc(C(F)(F)F)c4)cccc23)cc(OC)c1 |
| InChI | InChI=1S/C25H19F6N5O3/c1-38-17-9-16(10-18(11-17)39-2)34-22-19-4-3-5-20(21(19)32-12-33-22)36-23(37)35-15-7-13(24(26,27)28)6-14(8-15)25(29,30)31/h3-12H,1-2H3,(H,32,33,34)(H2,35,36,37) |
| InChIKey | FZVSLRQJPDBKOZ-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 97.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.45 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |