C25H26N2O4 — CID 134159801
tert-butyl 4-(9H-fluoren-9-ylmethoxycarbonylamino)-1-methylpyrrole-2-carboxylate (PubChem CID 134159801) has the molecular formula C25H26N2O4 and a molecular weight of 418.49 g/mol. Its IUPAC name is tert-butyl 4-(9H-fluoren-9-ylmethoxycarbonylamino)-1-methylpyrrole-2-carboxylate.
| Compound Name | tert-butyl 4-(9H-fluoren-9-ylmethoxycarbonylamino)-1-methylpyrrole-2-carboxylate |
|---|---|
| PubChem CID | 134159801 |
| Molecular Formula | C25H26N2O4 |
| Molecular Weight | 418.49 g/mol |
| Exact Mass | 418.19 |
| IUPAC Name | tert-butyl 4-(9H-fluoren-9-ylmethoxycarbonylamino)-1-methylpyrrole-2-carboxylate |
| SMILES | Cn1cc(NC(=O)OCC2c3ccccc3-c3ccccc32)cc1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C25H26N2O4/c1-25(2,3)31-23(28)22-13-16(14-27(22)4)26-24(29)30-15-21-19-11-7-5-9-17(19)18-10-6-8-12-20(18)21/h5-14,21H,15H2,1-4H3,(H,26,29) |
| InChIKey | ZCKDRILMRVSADL-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.49 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |