C19H10N2O — CID 134163455
9,15-diazapentacyclo[11.8.0.02,10.03,8.016,21]henicosa-1(21),2,4,6,8,10,12,14,16,18-decaen-20-one (PubChem CID 134163455) has the molecular formula C19H10N2O and a molecular weight of 282.30 g/mol. Its IUPAC name is 9,15-diazapentacyclo[11.8.0.02,10.03,8.016,21]henicosa-1(21),2,4,6,8,10,12,14,16,18-decaen-20-one.
| Compound Name | 9,15-diazapentacyclo[11.8.0.02,10.03,8.016,21]henicosa-1(21),2,4,6,8,10,12,14,16,18-decaen-20-one |
|---|---|
| PubChem CID | 134163455 |
| Molecular Formula | C19H10N2O |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.08 |
| IUPAC Name | 9,15-diazapentacyclo[11.8.0.02,10.03,8.016,21]henicosa-1(21),2,4,6,8,10,12,14,16,18-decaen-20-one |
| SMILES | O=C1C=CC=c2ncc3ccc4c(c3c21)=c1ccccc1=N4 |
| InChI | InChI=1S/C19H10N2O/c22-16-7-3-6-14-19(16)17-11(10-20-14)8-9-15-18(17)12-4-1-2-5-13(12)21-15/h1-10H |
| InChIKey | YCTXPHAQNRFZHQ-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 42.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |