C46H48O5S2 — CID 134170419
[2-[9-(2,2-dimethylpropoxy)-9-(2-sulfanylcyclohexyl)xanthen-2-yl]-10-oxo-9-(thiolan-3-yl)anthracen-9-yl] 2-methylprop-2-enoate (PubChem CID 134170419) has the molecular formula C46H48O5S2 and a molecular weight of 745.02 g/mol. Its IUPAC name is [2-[9-(2,2-dimethylpropoxy)-9-(2-sulfanylcyclohexyl)xanthen-2-yl]-10-oxo-9-(thiolan-3-yl)anthracen-9-yl] 2-methylprop-2-enoate.
| Compound Name | [2-[9-(2,2-dimethylpropoxy)-9-(2-sulfanylcyclohexyl)xanthen-2-yl]-10-oxo-9-(thiolan-3-yl)anthracen-9-yl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 134170419 |
| Molecular Formula | C46H48O5S2 |
| Molecular Weight | 745.02 g/mol |
| Exact Mass | 744.29 |
| IUPAC Name | [2-[9-(2,2-dimethylpropoxy)-9-(2-sulfanylcyclohexyl)xanthen-2-yl]-10-oxo-9-(thiolan-3-yl)anthracen-9-yl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC1(C2CCSC2)c2ccccc2C(=O)c2ccc(-c3ccc4c(c3)C(OCC(C)(C)C)(C3CCCCC3S)c3ccccc3O4)cc21 |
| InChI | InChI=1S/C46H48O5S2/c1-28(2)43(48)51-45(31-22-23-53-26-31)34-13-7-6-12-32(34)42(47)33-20-18-29(24-37(33)45)30-19-21-40-38(25-30)46(49-27-44(3,4)5,36-15-9-11-17-41(36)52)35-14-8-10-16-39(35)50-40/h6-8,10,12-14,16,18-21,24-25,31,36,41,52H,1,9,11,15,17,22-23,26-27H2,2-5H3 |
| InChIKey | IWFYKHKEDDHJJY-UHFFFAOYSA-N |
| XLogP | 10.91 |
| TPSA | 61.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 745.02 |
| LogP ≤ 5 | 10.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|