C21H26F6O5 — CID 134171399
[1-[1-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-1-oxopropan-2-yl]oxy-3-tricyclo[5.3.1.04,9]undecanyl] 2-methylprop-2-enoate (PubChem CID 134171399) has the molecular formula C21H26F6O5 and a molecular weight of 472.42 g/mol. Its IUPAC name is [1-[1-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-1-oxopropan-2-yl]oxy-3-tricyclo[5.3.1.04,9]undecanyl] 2-methylprop-2-enoate.
| Compound Name | [1-[1-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-1-oxopropan-2-yl]oxy-3-tricyclo[5.3.1.04,9]undecanyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 134171399 |
| Molecular Formula | C21H26F6O5 |
| Molecular Weight | 472.42 g/mol |
| Exact Mass | 472.17 |
| IUPAC Name | [1-[1-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-1-oxopropan-2-yl]oxy-3-tricyclo[5.3.1.04,9]undecanyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC1CC2(OC(C)C(=O)OC(C(F)(F)F)C(F)(F)F)CC3CCC1C(C3)C2 |
| InChI | InChI=1S/C21H26F6O5/c1-10(2)16(28)30-15-9-19(7-12-4-5-14(15)13(6-12)8-19)32-11(3)17(29)31-18(20(22,23)24)21(25,26)27/h11-15,18H,1,4-9H2,2-3H3 |
| InChIKey | JZDLVHNHEJYUPR-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.42 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|