C38H25N3O2 — CID 134179109
25-(4,6-diphenylpyrimidin-2-yl)-3,10-dioxa-25-azahexacyclo[12.11.0.02,11.04,9.015,24.017,22]pentacosa-1(14),2(11),4,6,8,12,15(24),16,18,20-decaene (PubChem CID 134179109) has the molecular formula C38H25N3O2 and a molecular weight of 555.64 g/mol. Its IUPAC name is 25-(4,6-diphenylpyrimidin-2-yl)-3,10-dioxa-25-azahexacyclo[12.11.0.02,11.04,9.015,24.017,22]pentacosa-1(14),2(11),4,6,8,12,15(24),16,18,20-decaene.
| Compound Name | 25-(4,6-diphenylpyrimidin-2-yl)-3,10-dioxa-25-azahexacyclo[12.11.0.02,11.04,9.015,24.017,22]pentacosa-1(14),2(11),4,6,8,12,15(24),16,18,20-decaene |
|---|---|
| PubChem CID | 134179109 |
| Molecular Formula | C38H25N3O2 |
| Molecular Weight | 555.64 g/mol |
| Exact Mass | 555.19 |
| IUPAC Name | 25-(4,6-diphenylpyrimidin-2-yl)-3,10-dioxa-25-azahexacyclo[12.11.0.02,11.04,9.015,24.017,22]pentacosa-1(14),2(11),4,6,8,12,15(24),16,18,20-decaene |
| SMILES | C1=CC2=Cc3c(n(-c4nc(-c5ccccc5)cc(-c5ccccc5)n4)c4c5c(ccc34)Oc3ccccc3O5)CC2C=C1 |
| InChI | InChI=1S/C38H25N3O2/c1-3-11-24(12-4-1)30-23-31(25-13-5-2-6-14-25)40-38(39-30)41-32-22-27-16-8-7-15-26(27)21-29(32)28-19-20-35-37(36(28)41)43-34-18-10-9-17-33(34)42-35/h1-21,23,27H,22H2 |
| InChIKey | DSTHTCRMJHWENT-UHFFFAOYSA-N |
| XLogP | 9.33 |
| TPSA | 49.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.64 |
| LogP ≤ 5 | 9.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |