C20H22N6O4S2 — CID 134181610
2-[[6-(2-aminophenyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-3-yl]methyl]-4,5-dimethoxy-N,N-dimethylbenzenesulfonamide (PubChem CID 134181610) has the molecular formula C20H22N6O4S2 and a molecular weight of 474.57 g/mol. Its IUPAC name is 2-[[6-(2-aminophenyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-3-yl]methyl]-4,5-dimethoxy-N,N-dimethylbenzenesulfonamide.
| Compound Name | 2-[[6-(2-aminophenyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-3-yl]methyl]-4,5-dimethoxy-N,N-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 134181610 |
| Molecular Formula | C20H22N6O4S2 |
| Molecular Weight | 474.57 g/mol |
| Exact Mass | 474.11 |
| IUPAC Name | 2-[[6-(2-aminophenyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-3-yl]methyl]-4,5-dimethoxy-N,N-dimethylbenzenesulfonamide |
| SMILES | COc1cc(Cc2nnc3sc(-c4ccccc4N)nn23)c(S(=O)(=O)N(C)C)cc1OC |
| InChI | InChI=1S/C20H22N6O4S2/c1-25(2)32(27,28)17-11-16(30-4)15(29-3)9-12(17)10-18-22-23-20-26(18)24-19(31-20)13-7-5-6-8-14(13)21/h5-9,11H,10,21H2,1-4H3 |
| InChIKey | UALHFAVXYNMFPJ-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 124.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.57 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|