C21H21ClN6O4S2 — CID 163864166
N-[[2-[[6-(2-chloro-4-nitrophenyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-3-yl]methyl]-4,5-dimethoxyphenyl]-methylidene-λ4-sulfanyl]-N-methylmethanamine (PubChem CID 163864166) has the molecular formula C21H21ClN6O4S2 and a molecular weight of 521.02 g/mol. Its IUPAC name is N-[[2-[[6-(2-chloro-4-nitrophenyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-3-yl]methyl]-4,5-dimethoxyphenyl]-methylidene-λ4-sulfanyl]-N-methylmethanamine.
| Compound Name | N-[[2-[[6-(2-chloro-4-nitrophenyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-3-yl]methyl]-4,5-dimethoxyphenyl]-methylidene-λ4-sulfanyl]-N-methylmethanamine |
|---|---|
| PubChem CID | 163864166 |
| Molecular Formula | C21H21ClN6O4S2 |
| Molecular Weight | 521.02 g/mol |
| Exact Mass | 520.08 |
| IUPAC Name | N-[[2-[[6-(2-chloro-4-nitrophenyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-3-yl]methyl]-4,5-dimethoxyphenyl]-methylidene-λ4-sulfanyl]-N-methylmethanamine |
| SMILES | C=S(c1cc(OC)c(OC)cc1Cc1nnc2sc(-c3ccc([N+](=O)[O-])cc3Cl)nn12)N(C)C |
| InChI | InChI=1S/C21H21ClN6O4S2/c1-26(2)34(5)18-11-17(32-4)16(31-3)8-12(18)9-19-23-24-21-27(19)25-20(33-21)14-7-6-13(28(29)30)10-15(14)22/h6-8,10-11H,5,9H2,1-4H3 |
| InChIKey | PFEBOFILWYWVOI-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 107.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.02 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|