C8H10N2 — CID 134198615
N-methylidenecyclohexa-2,4-diene-1-carboximidamide (PubChem CID 134198615) has the molecular formula C8H10N2 and a molecular weight of 134.18 g/mol. Its IUPAC name is N-methylidenecyclohexa-2,4-diene-1-carboximidamide.
| Compound Name | N-methylidenecyclohexa-2,4-diene-1-carboximidamide |
|---|---|
| PubChem CID | 134198615 |
| Molecular Formula | C8H10N2 |
| Molecular Weight | 134.18 g/mol |
| Exact Mass | 134.08 |
| IUPAC Name | N-methylidenecyclohexa-2,4-diene-1-carboximidamide |
| SMILES | [H]/N=C(\N=C)C1C=CC=CC1 |
| InChI | InChI=1S/C8H10N2/c1-10-8(9)7-5-3-2-4-6-7/h2-5,7,9H,1,6H2/b9-8- |
| InChIKey | LNTNMIGGROMPTK-HJWRWDBZSA-N |
| XLogP | 1.80 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 134.18 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|