C59H109ClN2O — CID 134205263
dimethyl-[3-[[(9Z,12Z)-octadeca-9,12-dienoyl]-[(9Z,12Z)-octadeca-9,12-dienyl]amino]propyl]-[(9Z,12Z)-octadeca-9,12-dienyl]azanium chloride (PubChem CID 134205263) has the molecular formula C59H109ClN2O and a molecular weight of 897.99 g/mol. Its IUPAC name is dimethyl-[3-[[(9Z,12Z)-octadeca-9,12-dienoyl]-[(9Z,12Z)-octadeca-9,12-dienyl]amino]propyl]-[(9Z,12Z)-octadeca-9,12-dienyl]azanium chloride.
| Compound Name | dimethyl-[3-[[(9Z,12Z)-octadeca-9,12-dienoyl]-[(9Z,12Z)-octadeca-9,12-dienyl]amino]propyl]-[(9Z,12Z)-octadeca-9,12-dienyl]azanium chloride |
|---|---|
| PubChem CID | 134205263 |
| Molecular Formula | C59H109ClN2O |
| Molecular Weight | 897.99 g/mol |
| Exact Mass | 896.82 |
| IUPAC Name | dimethyl-[3-[[(9Z,12Z)-octadeca-9,12-dienoyl]-[(9Z,12Z)-octadeca-9,12-dienyl]amino]propyl]-[(9Z,12Z)-octadeca-9,12-dienyl]azanium chloride |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCN(CCC[N+](C)(C)CCCCCCCC/C=C\C/C=C\CCCCC)C(=O)CCCCCCC/C=C\C/C=C\CCCCC.[Cl-] |
| InChI | InChI=1S/C59H109N2O.ClH/c1-6-9-12-15-18-21-24-27-30-33-36-39-42-45-48-51-55-60(59(62)54-50-47-44-41-38-35-32-29-26-23-20-17-14-11-8-3)56-53-58-61(4,5)57-52-49-46-43-40-37-34-31-28-25-22-19-16-13-10-7-2;/h18-23,27-32H,6-17,24-26,33-58H2,1-5H3;1H/q+1;/p-1/b21-18-,22-19-,23-20-,30-27-,31-28-,32-29-; |
| InChIKey | BCXAFYVJRHYTKL-WSQMFHAPSA-M |
| XLogP | 15.73 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 48 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 897.99 |
| LogP ≤ 5 | 15.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|