C23H20N6O2 — CID 134208826
7-benzyl-3-cyclopropyl-8-(imidazo[1,2-a]pyridin-2-ylmethyl)purine-2,6-dione (PubChem CID 134208826) has the molecular formula C23H20N6O2 and a molecular weight of 412.45 g/mol. Its IUPAC name is 7-benzyl-3-cyclopropyl-8-(imidazo[1,2-a]pyridin-2-ylmethyl)purine-2,6-dione.
| Compound Name | 7-benzyl-3-cyclopropyl-8-(imidazo[1,2-a]pyridin-2-ylmethyl)purine-2,6-dione |
|---|---|
| PubChem CID | 134208826 |
| Molecular Formula | C23H20N6O2 |
| Molecular Weight | 412.45 g/mol |
| Exact Mass | 412.16 |
| IUPAC Name | 7-benzyl-3-cyclopropyl-8-(imidazo[1,2-a]pyridin-2-ylmethyl)purine-2,6-dione |
| SMILES | O=c1[nH]c(=O)n(C2CC2)c2nc(Cc3cn4ccccc4n3)n(Cc3ccccc3)c12 |
| InChI | InChI=1S/C23H20N6O2/c30-22-20-21(29(17-9-10-17)23(31)26-22)25-19(28(20)13-15-6-2-1-3-7-15)12-16-14-27-11-5-4-8-18(27)24-16/h1-8,11,14,17H,9-10,12-13H2,(H,26,30,31) |
| InChIKey | NFUIGWIHITWNAY-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 89.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.45 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |