C20H28N5O2+ — CID 7137117
(7-benzyl-3-methyl-2,6-dioxopurin-8-yl)methyl-butyl-ethylazanium (PubChem CID 7137117) has the molecular formula C20H28N5O2+ and a molecular weight of 370.48 g/mol. Its IUPAC name is (7-benzyl-3-methyl-2,6-dioxopurin-8-yl)methyl-butyl-ethylazanium.
| Compound Name | (7-benzyl-3-methyl-2,6-dioxopurin-8-yl)methyl-butyl-ethylazanium |
|---|---|
| PubChem CID | 7137117 |
| Molecular Formula | C20H28N5O2+ |
| Molecular Weight | 370.48 g/mol |
| Exact Mass | 370.22 |
| IUPAC Name | (7-benzyl-3-methyl-2,6-dioxopurin-8-yl)methyl-butyl-ethylazanium |
| SMILES | CCCC[NH+](CC)Cc1nc2c(c(=O)[nH]c(=O)n2C)n1Cc1ccccc1 |
| InChI | InChI=1S/C20H27N5O2/c1-4-6-12-24(5-2)14-16-21-18-17(19(26)22-20(27)23(18)3)25(16)13-15-10-8-7-9-11-15/h7-11H,4-6,12-14H2,1-3H3,(H,22,26,27)/p+1 |
| InChIKey | NTJOJVGTMSKQJU-UHFFFAOYSA-O |
| XLogP | 0.68 |
| TPSA | 77.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.48 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |