C26H26N6O2 — CID 122505998
7-benzyl-3-cyclopropyl-8-[(6-propan-2-yl-1H-benzimidazol-2-yl)methyl]purine-2,6-dione (PubChem CID 122505998) has the molecular formula C26H26N6O2 and a molecular weight of 454.53 g/mol. Its IUPAC name is 7-benzyl-3-cyclopropyl-8-[(6-propan-2-yl-1H-benzimidazol-2-yl)methyl]purine-2,6-dione.
| Compound Name | 7-benzyl-3-cyclopropyl-8-[(6-propan-2-yl-1H-benzimidazol-2-yl)methyl]purine-2,6-dione |
|---|---|
| PubChem CID | 122505998 |
| Molecular Formula | C26H26N6O2 |
| Molecular Weight | 454.53 g/mol |
| Exact Mass | 454.21 |
| IUPAC Name | 7-benzyl-3-cyclopropyl-8-[(6-propan-2-yl-1H-benzimidazol-2-yl)methyl]purine-2,6-dione |
| SMILES | CC(C)c1ccc2nc(Cc3nc4c(c(=O)[nH]c(=O)n4C4CC4)n3Cc3ccccc3)[nH]c2c1 |
| InChI | InChI=1S/C26H26N6O2/c1-15(2)17-8-11-19-20(12-17)28-21(27-19)13-22-29-24-23(31(22)14-16-6-4-3-5-7-16)25(33)30-26(34)32(24)18-9-10-18/h3-8,11-12,15,18H,9-10,13-14H2,1-2H3,(H,27,28)(H,30,33,34) |
| InChIKey | ACVALPIXZNTOMV-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 101.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.53 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |