C23H20N6O2 — CID 122506014
8-(1H-benzimidazol-2-ylmethyl)-7-benzyl-3-cyclopropylpurine-2,6-dione (PubChem CID 122506014) has the molecular formula C23H20N6O2 and a molecular weight of 412.45 g/mol. Its IUPAC name is 8-(1H-benzimidazol-2-ylmethyl)-7-benzyl-3-cyclopropylpurine-2,6-dione.
| Compound Name | 8-(1H-benzimidazol-2-ylmethyl)-7-benzyl-3-cyclopropylpurine-2,6-dione |
|---|---|
| PubChem CID | 122506014 |
| Molecular Formula | C23H20N6O2 |
| Molecular Weight | 412.45 g/mol |
| Exact Mass | 412.16 |
| IUPAC Name | 8-(1H-benzimidazol-2-ylmethyl)-7-benzyl-3-cyclopropylpurine-2,6-dione |
| SMILES | O=c1[nH]c(=O)n(C2CC2)c2nc(Cc3nc4ccccc4[nH]3)n(Cc3ccccc3)c12 |
| InChI | InChI=1S/C23H20N6O2/c30-22-20-21(29(15-10-11-15)23(31)27-22)26-19(28(20)13-14-6-2-1-3-7-14)12-18-24-16-8-4-5-9-17(16)25-18/h1-9,15H,10-13H2,(H,24,25)(H,27,30,31) |
| InChIKey | GLUWCNQLKSIYKQ-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 101.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.45 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |