C23H32N6O3 — CID 134215588
3-methanimidoyl-6-[3-[3-(methylamino)-2-nitrosopropoxy]phenyl]-4-morpholin-4-yl-N-propan-2-ylpyridin-2-amine (PubChem CID 134215588) has the molecular formula C23H32N6O3 and a molecular weight of 440.55 g/mol. Its IUPAC name is 3-methanimidoyl-6-[3-[3-(methylamino)-2-nitrosopropoxy]phenyl]-4-morpholin-4-yl-N-propan-2-ylpyridin-2-amine.
| Compound Name | 3-methanimidoyl-6-[3-[3-(methylamino)-2-nitrosopropoxy]phenyl]-4-morpholin-4-yl-N-propan-2-ylpyridin-2-amine |
|---|---|
| PubChem CID | 134215588 |
| Molecular Formula | C23H32N6O3 |
| Molecular Weight | 440.55 g/mol |
| Exact Mass | 440.25 |
| IUPAC Name | 3-methanimidoyl-6-[3-[3-(methylamino)-2-nitrosopropoxy]phenyl]-4-morpholin-4-yl-N-propan-2-ylpyridin-2-amine |
| SMILES | [H]/N=C/c1c(N2CCOCC2)cc(-c2cccc(OCC(CNC)N=O)c2)nc1NC(C)C |
| InChI | InChI=1S/C23H32N6O3/c1-16(2)26-23-20(13-24)22(29-7-9-31-10-8-29)12-21(27-23)17-5-4-6-19(11-17)32-15-18(28-30)14-25-3/h4-6,11-13,16,18,24-25H,7-10,14-15H2,1-3H3,(H,26,27)/b24-13+ |
| InChIKey | FQGNBMZQRPCDEP-ZMOGYAJESA-N |
| XLogP | 3.14 |
| TPSA | 111.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.55 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|