C25H40N6O2 — CID 134216456
1-[3-[4-(6-aminohexylamino)-5-methanimidoyl-6-(propan-2-ylamino)-2-pyridinyl]phenoxy]-3-(methylamino)propan-2-ol (PubChem CID 134216456) has the molecular formula C25H40N6O2 and a molecular weight of 456.64 g/mol. Its IUPAC name is 1-[3-[4-(6-aminohexylamino)-5-methanimidoyl-6-(propan-2-ylamino)-2-pyridinyl]phenoxy]-3-(methylamino)propan-2-ol.
| Compound Name | 1-[3-[4-(6-aminohexylamino)-5-methanimidoyl-6-(propan-2-ylamino)-2-pyridinyl]phenoxy]-3-(methylamino)propan-2-ol |
|---|---|
| PubChem CID | 134216456 |
| Molecular Formula | C25H40N6O2 |
| Molecular Weight | 456.64 g/mol |
| Exact Mass | 456.32 |
| IUPAC Name | 1-[3-[4-(6-aminohexylamino)-5-methanimidoyl-6-(propan-2-ylamino)-2-pyridinyl]phenoxy]-3-(methylamino)propan-2-ol |
| SMILES | [H]/N=C/c1c(NCCCCCCN)cc(-c2cccc(OCC(O)CNC)c2)nc1NC(C)C |
| InChI | InChI=1S/C25H40N6O2/c1-18(2)30-25-22(15-27)24(29-12-7-5-4-6-11-26)14-23(31-25)19-9-8-10-21(13-19)33-17-20(32)16-28-3/h8-10,13-15,18,20,27-28,32H,4-7,11-12,16-17,26H2,1-3H3,(H2,29,30,31)/b27-15+ |
| InChIKey | SUKHVQKNCSGQMC-JFLMPSFJSA-N |
| XLogP | 3.46 |
| TPSA | 128.31 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.64 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|