C23H36N6O2 — CID 134216423
(2S)-1-[3-[5-methanimidoyl-4-[3-(methylamino)propylamino]-6-(propan-2-ylamino)-2-pyridinyl]phenoxy]-3-(methylamino)propan-2-ol (PubChem CID 134216423) has the molecular formula C23H36N6O2 and a molecular weight of 428.58 g/mol. Its IUPAC name is (2S)-1-[3-[5-methanimidoyl-4-[3-(methylamino)propylamino]-6-(propan-2-ylamino)-2-pyridinyl]phenoxy]-3-(methylamino)propan-2-ol.
| Compound Name | (2S)-1-[3-[5-methanimidoyl-4-[3-(methylamino)propylamino]-6-(propan-2-ylamino)-2-pyridinyl]phenoxy]-3-(methylamino)propan-2-ol |
|---|---|
| PubChem CID | 134216423 |
| Molecular Formula | C23H36N6O2 |
| Molecular Weight | 428.58 g/mol |
| Exact Mass | 428.29 |
| IUPAC Name | (2S)-1-[3-[5-methanimidoyl-4-[3-(methylamino)propylamino]-6-(propan-2-ylamino)-2-pyridinyl]phenoxy]-3-(methylamino)propan-2-ol |
| SMILES | [H]/N=C/c1c(NCCCNC)cc(-c2cccc(OC[C@@H](O)CNC)c2)nc1NC(C)C |
| InChI | InChI=1S/C23H36N6O2/c1-16(2)28-23-20(13-24)22(27-10-6-9-25-3)12-21(29-23)17-7-5-8-19(11-17)31-15-18(30)14-26-4/h5,7-8,11-13,16,18,24-26,30H,6,9-10,14-15H2,1-4H3,(H2,27,28,29)/b24-13+/t18-/m0/s1 |
| InChIKey | SUPGXBWMLDDCKQ-VQXFCIMOSA-N |
| XLogP | 2.55 |
| TPSA | 114.32 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.58 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|