C24H23F5N6 — CID 134229958
2-[4-[[2-[6-(1,1,2,2,2-pentafluoroethyl)pyrrolo[2,1-f][1,2,4]triazin-4-yl]-2,7-diazaspiro[4.4]nonan-7-yl]methyl]phenyl]acetonitrile (PubChem CID 134229958) has the molecular formula C24H23F5N6 and a molecular weight of 490.48 g/mol. Its IUPAC name is 2-[4-[[2-[6-(1,1,2,2,2-pentafluoroethyl)pyrrolo[2,1-f][1,2,4]triazin-4-yl]-2,7-diazaspiro[4.4]nonan-7-yl]methyl]phenyl]acetonitrile.
| Compound Name | 2-[4-[[2-[6-(1,1,2,2,2-pentafluoroethyl)pyrrolo[2,1-f][1,2,4]triazin-4-yl]-2,7-diazaspiro[4.4]nonan-7-yl]methyl]phenyl]acetonitrile |
|---|---|
| PubChem CID | 134229958 |
| Molecular Formula | C24H23F5N6 |
| Molecular Weight | 490.48 g/mol |
| Exact Mass | 490.19 |
| IUPAC Name | 2-[4-[[2-[6-(1,1,2,2,2-pentafluoroethyl)pyrrolo[2,1-f][1,2,4]triazin-4-yl]-2,7-diazaspiro[4.4]nonan-7-yl]methyl]phenyl]acetonitrile |
| SMILES | N#CCc1ccc(CN2CCC3(CCN(c4ncnn5cc(C(F)(F)C(F)(F)F)cc45)C3)C2)cc1 |
| InChI | InChI=1S/C24H23F5N6/c25-23(26,24(27,28)29)19-11-20-21(31-16-32-35(20)13-19)34-10-7-22(15-34)6-9-33(14-22)12-18-3-1-17(2-4-18)5-8-30/h1-4,11,13,16H,5-7,9-10,12,14-15H2 |
| InChIKey | FXYHDGMBKWVXTP-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 60.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.48 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|