C25H31F3N6O — CID 134241320
2-[N-methyl-4-[[2-[6-(2,2,2-trifluoroethyl)pyrrolo[2,1-f][1,2,4]triazin-4-yl]-2,7-diazaspiro[4.4]nonan-7-yl]methyl]anilino]ethanol (PubChem CID 134241320) has the molecular formula C25H31F3N6O and a molecular weight of 488.56 g/mol. Its IUPAC name is 2-[N-methyl-4-[[2-[6-(2,2,2-trifluoroethyl)pyrrolo[2,1-f][1,2,4]triazin-4-yl]-2,7-diazaspiro[4.4]nonan-7-yl]methyl]anilino]ethanol.
| Compound Name | 2-[N-methyl-4-[[2-[6-(2,2,2-trifluoroethyl)pyrrolo[2,1-f][1,2,4]triazin-4-yl]-2,7-diazaspiro[4.4]nonan-7-yl]methyl]anilino]ethanol |
|---|---|
| PubChem CID | 134241320 |
| Molecular Formula | C25H31F3N6O |
| Molecular Weight | 488.56 g/mol |
| Exact Mass | 488.25 |
| IUPAC Name | 2-[N-methyl-4-[[2-[6-(2,2,2-trifluoroethyl)pyrrolo[2,1-f][1,2,4]triazin-4-yl]-2,7-diazaspiro[4.4]nonan-7-yl]methyl]anilino]ethanol |
| SMILES | CN(CCO)c1ccc(CN2CCC3(CCN(c4ncnn5cc(CC(F)(F)F)cc45)C3)C2)cc1 |
| InChI | InChI=1S/C25H31F3N6O/c1-31(10-11-35)21-4-2-19(3-5-21)14-32-8-6-24(16-32)7-9-33(17-24)23-22-12-20(13-25(26,27)28)15-34(22)30-18-29-23/h2-5,12,15,18,35H,6-11,13-14,16-17H2,1H3 |
| InChIKey | FBDMESQLKYYBRM-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 60.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.56 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|