C22H25F3N6O2S — CID 134241411
4-[[2-[6-(2,2,2-trifluoroethyl)pyrrolo[2,1-f][1,2,4]triazin-4-yl]-2,7-diazaspiro[4.4]nonan-7-yl]methyl]benzenesulfonamide (PubChem CID 134241411) has the molecular formula C22H25F3N6O2S and a molecular weight of 494.54 g/mol. Its IUPAC name is 4-[[2-[6-(2,2,2-trifluoroethyl)pyrrolo[2,1-f][1,2,4]triazin-4-yl]-2,7-diazaspiro[4.4]nonan-7-yl]methyl]benzenesulfonamide.
| Compound Name | 4-[[2-[6-(2,2,2-trifluoroethyl)pyrrolo[2,1-f][1,2,4]triazin-4-yl]-2,7-diazaspiro[4.4]nonan-7-yl]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 134241411 |
| Molecular Formula | C22H25F3N6O2S |
| Molecular Weight | 494.54 g/mol |
| Exact Mass | 494.17 |
| IUPAC Name | 4-[[2-[6-(2,2,2-trifluoroethyl)pyrrolo[2,1-f][1,2,4]triazin-4-yl]-2,7-diazaspiro[4.4]nonan-7-yl]methyl]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(CN2CCC3(CCN(c4ncnn5cc(CC(F)(F)F)cc45)C3)C2)cc1 |
| InChI | InChI=1S/C22H25F3N6O2S/c23-22(24,25)10-17-9-19-20(27-15-28-31(19)12-17)30-8-6-21(14-30)5-7-29(13-21)11-16-1-3-18(4-2-16)34(26,32)33/h1-4,9,12,15H,5-8,10-11,13-14H2,(H2,26,32,33) |
| InChIKey | IJCUMZHAPJDDIF-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 96.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.54 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |