C25H30F3N7O — CID 134229960
4-[4-[[2-[2-(2,2,2-trifluoroethyl)pyrazolo[3,4-d]pyrimidin-4-yl]-2,7-diazaspiro[4.4]nonan-7-yl]methyl]phenyl]morpholine (PubChem CID 134229960) has the molecular formula C25H30F3N7O and a molecular weight of 501.56 g/mol. Its IUPAC name is 4-[4-[[2-[2-(2,2,2-trifluoroethyl)pyrazolo[3,4-d]pyrimidin-4-yl]-2,7-diazaspiro[4.4]nonan-7-yl]methyl]phenyl]morpholine.
| Compound Name | 4-[4-[[2-[2-(2,2,2-trifluoroethyl)pyrazolo[3,4-d]pyrimidin-4-yl]-2,7-diazaspiro[4.4]nonan-7-yl]methyl]phenyl]morpholine |
|---|---|
| PubChem CID | 134229960 |
| Molecular Formula | C25H30F3N7O |
| Molecular Weight | 501.56 g/mol |
| Exact Mass | 501.25 |
| IUPAC Name | 4-[4-[[2-[2-(2,2,2-trifluoroethyl)pyrazolo[3,4-d]pyrimidin-4-yl]-2,7-diazaspiro[4.4]nonan-7-yl]methyl]phenyl]morpholine |
| SMILES | FC(F)(F)Cn1cc2c(N3CCC4(CCN(Cc5ccc(N6CCOCC6)cc5)C4)C3)ncnc2n1 |
| InChI | InChI=1S/C25H30F3N7O/c26-25(27,28)17-35-14-21-22(31-35)29-18-30-23(21)34-8-6-24(16-34)5-7-32(15-24)13-19-1-3-20(4-2-19)33-9-11-36-12-10-33/h1-4,14,18H,5-13,15-17H2 |
| InChIKey | ZBGNHLSLQXZESV-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 62.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.56 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|