C19H21Cl2NO3S — CID 134237971
4-(2,4-dichlorophenyl)-N-(4-hydroxy-4-methylcyclohexyl)benzenesulfonamide (PubChem CID 134237971) has the molecular formula C19H21Cl2NO3S and a molecular weight of 414.35 g/mol. Its IUPAC name is 4-(2,4-dichlorophenyl)-N-(4-hydroxy-4-methylcyclohexyl)benzenesulfonamide.
| Compound Name | 4-(2,4-dichlorophenyl)-N-(4-hydroxy-4-methylcyclohexyl)benzenesulfonamide |
|---|---|
| PubChem CID | 134237971 |
| Molecular Formula | C19H21Cl2NO3S |
| Molecular Weight | 414.35 g/mol |
| Exact Mass | 413.06 |
| IUPAC Name | 4-(2,4-dichlorophenyl)-N-(4-hydroxy-4-methylcyclohexyl)benzenesulfonamide |
| SMILES | CC1(O)CCC(NS(=O)(=O)c2ccc(-c3ccc(Cl)cc3Cl)cc2)CC1 |
| InChI | InChI=1S/C19H21Cl2NO3S/c1-19(23)10-8-15(9-11-19)22-26(24,25)16-5-2-13(3-6-16)17-7-4-14(20)12-18(17)21/h2-7,12,15,22-23H,8-11H2,1H3 |
| InChIKey | DZLRFXMJUKNZIM-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.35 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |