C21H38N2 — CID 134242689
N-methyl-N-[[5-methyl-1-(5-methylheptyl)pyrrolidin-2-yl]methyl]cyclohexa-1,5-dien-1-amine (PubChem CID 134242689) has the molecular formula C21H38N2 and a molecular weight of 318.55 g/mol. Its IUPAC name is N-methyl-N-[[5-methyl-1-(5-methylheptyl)pyrrolidin-2-yl]methyl]cyclohexa-1,5-dien-1-amine.
| Compound Name | N-methyl-N-[[5-methyl-1-(5-methylheptyl)pyrrolidin-2-yl]methyl]cyclohexa-1,5-dien-1-amine |
|---|---|
| PubChem CID | 134242689 |
| Molecular Formula | C21H38N2 |
| Molecular Weight | 318.55 g/mol |
| Exact Mass | 318.30 |
| IUPAC Name | N-methyl-N-[[5-methyl-1-(5-methylheptyl)pyrrolidin-2-yl]methyl]cyclohexa-1,5-dien-1-amine |
| SMILES | CCC(C)CCCCN1C(C)CCC1CN(C)C1=CCCC=C1 |
| InChI | InChI=1S/C21H38N2/c1-5-18(2)11-9-10-16-23-19(3)14-15-21(23)17-22(4)20-12-7-6-8-13-20/h7,12-13,18-19,21H,5-6,8-11,14-17H2,1-4H3 |
| InChIKey | WLCQWLNKYRPGHW-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.55 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|