C12H12N2O5S — CID 134247795
4-(2-methoxyphenyl)-2-sulfamoylfuran-3-carboxamide (PubChem CID 134247795) has the molecular formula C12H12N2O5S and a molecular weight of 296.30 g/mol. Its IUPAC name is 4-(2-methoxyphenyl)-2-sulfamoylfuran-3-carboxamide.
| Compound Name | 4-(2-methoxyphenyl)-2-sulfamoylfuran-3-carboxamide |
|---|---|
| PubChem CID | 134247795 |
| Molecular Formula | C12H12N2O5S |
| Molecular Weight | 296.30 g/mol |
| Exact Mass | 296.05 |
| IUPAC Name | 4-(2-methoxyphenyl)-2-sulfamoylfuran-3-carboxamide |
| SMILES | COc1ccccc1-c1coc(S(N)(=O)=O)c1C(N)=O |
| InChI | InChI=1S/C12H12N2O5S/c1-18-9-5-3-2-4-7(9)8-6-19-12(20(14,16)17)10(8)11(13)15/h2-6H,1H3,(H2,13,15)(H2,14,16,17) |
| InChIKey | MTJSHPAXKNBJOU-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 125.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.30 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |