C13H26N4O3S — CID 134256980
tert-butyl N-[4-methyl-1-[2-(methylcarbamothioyl)hydrazinyl]-1-oxopentan-3-yl]carbamate (PubChem CID 134256980) has the molecular formula C13H26N4O3S and a molecular weight of 318.44 g/mol. Its IUPAC name is tert-butyl N-[4-methyl-1-[2-(methylcarbamothioyl)hydrazinyl]-1-oxopentan-3-yl]carbamate.
| Compound Name | tert-butyl N-[4-methyl-1-[2-(methylcarbamothioyl)hydrazinyl]-1-oxopentan-3-yl]carbamate |
|---|---|
| PubChem CID | 134256980 |
| Molecular Formula | C13H26N4O3S |
| Molecular Weight | 318.44 g/mol |
| Exact Mass | 318.17 |
| IUPAC Name | tert-butyl N-[4-methyl-1-[2-(methylcarbamothioyl)hydrazinyl]-1-oxopentan-3-yl]carbamate |
| SMILES | CNC(=S)NNC(=O)CC(NC(=O)OC(C)(C)C)C(C)C |
| InChI | InChI=1S/C13H26N4O3S/c1-8(2)9(15-12(19)20-13(3,4)5)7-10(18)16-17-11(21)14-6/h8-9H,7H2,1-6H3,(H,15,19)(H,16,18)(H2,14,17,21) |
| InChIKey | KNMMTHSLWLKREE-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 91.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.44 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|